C25H19F2N3OS2 — CID 138566375
5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2,3-dimethyl-3H-isoindol-1-one (PubChem CID 138566375) has the molecular formula C25H19F2N3OS2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2,3-dimethyl-3H-isoindol-1-one.
| Compound Name | 5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2,3-dimethyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 138566375 |
| Molecular Formula | C25H19F2N3OS2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2,3-dimethyl-3H-isoindol-1-one |
| SMILES | CC1c2cc(-c3ccc(-c4cncc(NSc5ccc(F)cc5F)c4)s3)ccc2C(=O)N1C |
| InChI | InChI=1S/C25H19F2N3OS2/c1-14-20-10-15(3-5-19(20)25(31)30(14)2)22-7-8-23(32-22)16-9-18(13-28-12-16)29-33-24-6-4-17(26)11-21(24)27/h3-14,29H,1-2H3 |
| InChIKey | IUAQHXDVUKDHPR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|