C25H20F2N4S2 — CID 144576302
3-(2,4-difluoroanilino)sulfanyl-5-[5-(2-methyl-1-methylidene-3H-isoindol-5-yl)thiophen-2-yl]pyridin-2-amine (PubChem CID 144576302) has the molecular formula C25H20F2N4S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-(2,4-difluoroanilino)sulfanyl-5-[5-(2-methyl-1-methylidene-3H-isoindol-5-yl)thiophen-2-yl]pyridin-2-amine.
| Compound Name | 3-(2,4-difluoroanilino)sulfanyl-5-[5-(2-methyl-1-methylidene-3H-isoindol-5-yl)thiophen-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 144576302 |
| Molecular Formula | C25H20F2N4S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-(2,4-difluoroanilino)sulfanyl-5-[5-(2-methyl-1-methylidene-3H-isoindol-5-yl)thiophen-2-yl]pyridin-2-amine |
| SMILES | C=C1c2ccc(-c3ccc(-c4cnc(N)c(SNc5ccc(F)cc5F)c4)s3)cc2CN1C |
| InChI | InChI=1S/C25H20F2N4S2/c1-14-19-5-3-15(9-17(19)13-31(14)2)22-7-8-23(32-22)16-10-24(25(28)29-12-16)33-30-21-6-4-18(26)11-20(21)27/h3-12,30H,1,13H2,2H3,(H2,28,29) |
| InChIKey | SZRQMQGFIBKYMH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|