C23H15F2N3S2 — CID 138566321
N-(2,4-difluorophenyl)sulfanyl-5-[5-(1H-indol-5-yl)thiophen-2-yl]pyridin-3-amine (PubChem CID 138566321) has the molecular formula C23H15F2N3S2 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)sulfanyl-5-[5-(1H-indol-5-yl)thiophen-2-yl]pyridin-3-amine.
| Compound Name | N-(2,4-difluorophenyl)sulfanyl-5-[5-(1H-indol-5-yl)thiophen-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 138566321 |
| Molecular Formula | C23H15F2N3S2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-(2,4-difluorophenyl)sulfanyl-5-[5-(1H-indol-5-yl)thiophen-2-yl]pyridin-3-amine |
| SMILES | Fc1ccc(SNc2cncc(-c3ccc(-c4ccc5[nH]ccc5c4)s3)c2)c(F)c1 |
| InChI | InChI=1S/C23H15F2N3S2/c24-17-2-4-23(19(25)11-17)30-28-18-10-16(12-26-13-18)22-6-5-21(29-22)15-1-3-20-14(9-15)7-8-27-20/h1-13,27-28H |
| InChIKey | DCHCZZIRUYDHJL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|