C26H23F2N3O2S2 — CID 138566474
4-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-[[2-hydroxyethyl(methyl)amino]methyl]benzaldehyde (PubChem CID 138566474) has the molecular formula C26H23F2N3O2S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is 4-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-[[2-hydroxyethyl(methyl)amino]methyl]benzaldehyde.
| Compound Name | 4-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-[[2-hydroxyethyl(methyl)amino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 138566474 |
| Molecular Formula | C26H23F2N3O2S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 4-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-[[2-hydroxyethyl(methyl)amino]methyl]benzaldehyde |
| SMILES | CN(CCO)Cc1cc(-c2ccc(-c3cncc(NSc4ccc(F)cc4F)c3)s2)ccc1C=O |
| InChI | InChI=1S/C26H23F2N3O2S2/c1-31(8-9-32)15-20-10-17(2-3-18(20)16-33)24-6-7-25(34-24)19-11-22(14-29-13-19)30-35-26-5-4-21(27)12-23(26)28/h2-7,10-14,16,30,32H,8-9,15H2,1H3 |
| InChIKey | XXSQTVGNTQFILI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|