C29H25F2N3OS2 — CID 138566540
1-[1-butyl-5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]indol-3-yl]ethanone (PubChem CID 138566540) has the molecular formula C29H25F2N3OS2 and a molecular weight of 533.67 g/mol. Its IUPAC name is 1-[1-butyl-5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]indol-3-yl]ethanone.
| Compound Name | 1-[1-butyl-5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 138566540 |
| Molecular Formula | C29H25F2N3OS2 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 1-[1-butyl-5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]indol-3-yl]ethanone |
| SMILES | CCCCn1cc(C(C)=O)c2cc(-c3ccc(-c4cncc(NSc5ccc(F)cc5F)c4)s3)ccc21 |
| InChI | InChI=1S/C29H25F2N3OS2/c1-3-4-11-34-17-24(18(2)35)23-13-19(5-7-26(23)34)27-9-10-28(36-27)20-12-22(16-32-15-20)33-37-29-8-6-21(30)14-25(29)31/h5-10,12-17,33H,3-4,11H2,1-2H3 |
| InChIKey | FHHWBIKUXZFONW-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|