C10H11NS — CID 123404675
6,7-dimethyl-7H-thieno[3,2-b]azepine (PubChem CID 123404675) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 6,7-dimethyl-7H-thieno[3,2-b]azepine.
| Compound Name | 6,7-dimethyl-7H-thieno[3,2-b]azepine |
|---|---|
| PubChem CID | 123404675 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 6,7-dimethyl-7H-thieno[3,2-b]azepine |
| SMILES | CC1=CN=c2ccsc2=CC1C |
| InChI | InChI=1S/C10H11NS/c1-7-5-10-9(3-4-12-10)11-6-8(7)2/h3-7H,1-2H3 |
| InChIKey | QXYQZZYMQLAMNG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |