C10H13NS — CID 123639444
6,7-dimethyl-6,7-dihydro-5H-thieno[3,2-b]azepine (PubChem CID 123639444) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 6,7-dimethyl-6,7-dihydro-5H-thieno[3,2-b]azepine.
| Compound Name | 6,7-dimethyl-6,7-dihydro-5H-thieno[3,2-b]azepine |
|---|---|
| PubChem CID | 123639444 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 6,7-dimethyl-6,7-dihydro-5H-thieno[3,2-b]azepine |
| SMILES | CC1C=c2sccc2=NCC1C |
| InChI | InChI=1S/C10H13NS/c1-7-5-10-9(3-4-12-10)11-6-8(7)2/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | OELWCMZBLIXQCW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |