C15H25N3O4 — CID 123404977
(2,5-dihydroxypyrrol-1-yl) 6-(3,5-dimethylimidazolidin-4-yl)hexanoate (PubChem CID 123404977) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-(3,5-dimethylimidazolidin-4-yl)hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-(3,5-dimethylimidazolidin-4-yl)hexanoate |
|---|---|
| PubChem CID | 123404977 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-(3,5-dimethylimidazolidin-4-yl)hexanoate |
| SMILES | CC1NCN(C)C1CCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H25N3O4/c1-11-12(17(2)10-16-11)6-4-3-5-7-15(21)22-18-13(19)8-9-14(18)20/h8-9,11-12,16,19-20H,3-7,10H2,1-2H3 |
| InChIKey | JDTIRZPSFOVXJL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|