C19H27FO6S — CID 123405590
5-fluoro-6-(hydroxymethyl)-2-[2-(5-methoxy-2-methylhepta-2,4-dienyl)thiophen-3-yl]oxyoxane-3,4-diol (PubChem CID 123405590) has the molecular formula C19H27FO6S and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-fluoro-6-(hydroxymethyl)-2-[2-(5-methoxy-2-methylhepta-2,4-dienyl)thiophen-3-yl]oxyoxane-3,4-diol.
| Compound Name | 5-fluoro-6-(hydroxymethyl)-2-[2-(5-methoxy-2-methylhepta-2,4-dienyl)thiophen-3-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 123405590 |
| Molecular Formula | C19H27FO6S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 5-fluoro-6-(hydroxymethyl)-2-[2-(5-methoxy-2-methylhepta-2,4-dienyl)thiophen-3-yl]oxyoxane-3,4-diol |
| SMILES | CCC(=CC=C(C)Cc1sccc1OC1OC(CO)C(F)C(O)C1O)OC |
| InChI | InChI=1S/C19H27FO6S/c1-4-12(24-3)6-5-11(2)9-15-13(7-8-27-15)25-19-18(23)17(22)16(20)14(10-21)26-19/h5-8,14,16-19,21-23H,4,9-10H2,1-3H3 |
| InChIKey | NXSRPDRYMJIFBZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|