C20H34N2 — CID 123405820
4-(2,2-dimethylazepan-4-yl)-6,6-dimethyl-N-propan-2-ylcyclohepta-2,4-dien-1-imine (PubChem CID 123405820) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 4-(2,2-dimethylazepan-4-yl)-6,6-dimethyl-N-propan-2-ylcyclohepta-2,4-dien-1-imine.
| Compound Name | 4-(2,2-dimethylazepan-4-yl)-6,6-dimethyl-N-propan-2-ylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123405820 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 4-(2,2-dimethylazepan-4-yl)-6,6-dimethyl-N-propan-2-ylcyclohepta-2,4-dien-1-imine |
| SMILES | CC(C)/N=C1\C=CC(C2CCCNC(C)(C)C2)=CC(C)(C)C1 |
| InChI | InChI=1S/C20H34N2/c1-15(2)22-18-10-9-17(12-19(3,4)14-18)16-8-7-11-21-20(5,6)13-16/h9-10,12,15-16,21H,7-8,11,13-14H2,1-6H3/b22-18+ |
| InChIKey | HHQQCLRFNJDOFN-RELWKKBWSA-N |
| XLogP | 4.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|