C27H43N3 — CID 123967000
N-[2-[(5Z)-6-ethyl-5-prop-2-enylidene-4H-pyridin-3-yl]-2-imino-1-(3-methylcycloheptyl)ethyl]-2-methylhex-4-en-1-amine (PubChem CID 123967000) has the molecular formula C27H43N3 and a molecular weight of 409.66 g/mol. Its IUPAC name is N-[2-[(5Z)-6-ethyl-5-prop-2-enylidene-4H-pyridin-3-yl]-2-imino-1-(3-methylcycloheptyl)ethyl]-2-methylhex-4-en-1-amine.
| Compound Name | N-[2-[(5Z)-6-ethyl-5-prop-2-enylidene-4H-pyridin-3-yl]-2-imino-1-(3-methylcycloheptyl)ethyl]-2-methylhex-4-en-1-amine |
|---|---|
| PubChem CID | 123967000 |
| Molecular Formula | C27H43N3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.35 |
| IUPAC Name | N-[2-[(5Z)-6-ethyl-5-prop-2-enylidene-4H-pyridin-3-yl]-2-imino-1-(3-methylcycloheptyl)ethyl]-2-methylhex-4-en-1-amine |
| SMILES | [H]/N=C(\C1=CN=C(CC)/C(=C\C=C)C1)C(NCC(C)CC=CC)C1CCCCC(C)C1 |
| InChI | InChI=1S/C27H43N3/c1-6-9-13-21(5)18-30-27(23-15-11-10-14-20(4)16-23)26(28)24-17-22(12-7-2)25(8-3)29-19-24/h6-7,9,12,19-21,23,27-28,30H,2,8,10-11,13-18H2,1,3-5H3/b9-6?,22-12-,28-26+ |
| InChIKey | XTCRWYGYPPESBO-UQTYXBOYSA-N |
| XLogP | 7.03 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|