About [2-(2-formylbenzoyl)phenyl] N-propylcarbamate
[2-(2-formylbenzoyl)phenyl] N-propylcarbamate (PubChem CID 123406138) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is [2-(2-formylbenzoyl)phenyl] N-propylcarbamate.
Molecular Properties
| Compound Name | [2-(2-formylbenzoyl)phenyl] N-propylcarbamate |
| PubChem CID | 123406138 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [2-(2-formylbenzoyl)phenyl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccccc1C(=O)c1ccccc1C=O |
| InChI | InChI=1S/C18H17NO4/c1-2-11-19-18(22)23-16-10-6-5-9-15(16)17(21)14-8-4-3-7-13(14)12-20/h3-10,12H,2,11H2,1H3,(H,19,22) |
| InChIKey | DMDRHVJEZNITTE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-formylbenzoyl)phenyl] N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-formylbenzoyl)phenyl] N-propylcarbamate?
The IUPAC name of [2-(2-formylbenzoyl)phenyl] N-propylcarbamate (CID 123406138) is [2-(2-formylbenzoyl)phenyl] N-propylcarbamate.
What is the SMILES notation for [2-(2-formylbenzoyl)phenyl] N-propylcarbamate?
The canonical SMILES for [2-(2-formylbenzoyl)phenyl] N-propylcarbamate is CCCNC(=O)Oc1ccccc1C(=O)c1ccccc1C=O.
What is the InChIKey of [2-(2-formylbenzoyl)phenyl] N-propylcarbamate?
The InChIKey is DMDRHVJEZNITTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4/c1-2-11-19-18(22)23-16-10-6-5-9-15(16)17(21)14-8-4-3-7-13(14)12-20/h3-10,12H,2,11H2,1H3,(H,19,22).
What are the key properties of [2-(2-formylbenzoyl)phenyl] N-propylcarbamate?
[2-(2-formylbenzoyl)phenyl] N-propylcarbamate has a molecular weight of 311.34 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-formylbenzoyl)phenyl] N-propylcarbamate is sourced from PubChem (CID 123406138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).