About (3-acetyl-2-bromophenyl) N-propylcarbamate
(3-acetyl-2-bromophenyl) N-propylcarbamate (PubChem CID 175190417) has the molecular formula C12H14BrNO3
and a molecular weight of 300.15 g/mol. Its IUPAC name is (3-acetyl-2-bromophenyl) N-propylcarbamate.
Molecular Properties
| Compound Name | (3-acetyl-2-bromophenyl) N-propylcarbamate |
| PubChem CID | 175190417 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (3-acetyl-2-bromophenyl) N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1cccc(C(C)=O)c1Br |
| InChI | InChI=1S/C12H14BrNO3/c1-3-7-14-12(16)17-10-6-4-5-9(8(2)15)11(10)13/h4-6H,3,7H2,1-2H3,(H,14,16) |
| InChIKey | XWEFYZUPQORZQZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-acetyl-2-bromophenyl) N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyl-2-bromophenyl) N-propylcarbamate?
The IUPAC name of (3-acetyl-2-bromophenyl) N-propylcarbamate (CID 175190417) is (3-acetyl-2-bromophenyl) N-propylcarbamate.
What is the SMILES notation for (3-acetyl-2-bromophenyl) N-propylcarbamate?
The canonical SMILES for (3-acetyl-2-bromophenyl) N-propylcarbamate is CCCNC(=O)Oc1cccc(C(C)=O)c1Br.
What is the InChIKey of (3-acetyl-2-bromophenyl) N-propylcarbamate?
The InChIKey is XWEFYZUPQORZQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO3/c1-3-7-14-12(16)17-10-6-4-5-9(8(2)15)11(10)13/h4-6H,3,7H2,1-2H3,(H,14,16).
What are the key properties of (3-acetyl-2-bromophenyl) N-propylcarbamate?
(3-acetyl-2-bromophenyl) N-propylcarbamate has a molecular weight of 300.15 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyl-2-bromophenyl) N-propylcarbamate is sourced from PubChem (CID 175190417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).