C35H25F3N4 — CID 123408259
2-(1H-indol-3-yl)-3-[3-[3-(1-methyl-2,3-dihydroindol-2-yl)-1H-indol-5-yl]-4-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 123408259) has the molecular formula C35H25F3N4 and a molecular weight of 558.61 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-3-[3-[3-(1-methyl-2,3-dihydroindol-2-yl)-1H-indol-5-yl]-4-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | 2-(1H-indol-3-yl)-3-[3-[3-(1-methyl-2,3-dihydroindol-2-yl)-1H-indol-5-yl]-4-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 123408259 |
| Molecular Formula | C35H25F3N4 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 2-(1H-indol-3-yl)-3-[3-[3-(1-methyl-2,3-dihydroindol-2-yl)-1H-indol-5-yl]-4-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | CN1c2ccccc2CC1c1c[nH]c2ccc(-c3cc(C=C(C#N)c4c[nH]c5ccccc45)ccc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C35H25F3N4/c1-42-33-9-5-2-6-23(33)17-34(42)29-20-41-32-13-11-22(16-27(29)32)26-15-21(10-12-30(26)35(36,37)38)14-24(18-39)28-19-40-31-8-4-3-7-25(28)31/h2-16,19-20,34,40-41H,17H2,1H3 |
| InChIKey | YNRDZNAIVQJRSQ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|