C26H28F2N2O2+2 — CID 123408344
2-(6,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-7-yl)ethyl 1-methylpyridin-1-ium-2-carboxylate (PubChem CID 123408344) has the molecular formula C26H28F2N2O2+2 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-(6,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-7-yl)ethyl 1-methylpyridin-1-ium-2-carboxylate.
| Compound Name | 2-(6,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-7-yl)ethyl 1-methylpyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 123408344 |
| Molecular Formula | C26H28F2N2O2+2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 2-(6,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-7-yl)ethyl 1-methylpyridin-1-ium-2-carboxylate |
| SMILES | CCC1[n+]2ccccc2-c2c(F)cc(F)cc2C1(CC)CCOC(=O)c1cccc[n+]1C |
| InChI | InChI=1S/C26H28F2N2O2/c1-4-23-26(5-2,12-15-32-25(31)22-11-6-8-13-29(22)3)19-16-18(27)17-20(28)24(19)21-10-7-9-14-30(21)23/h6-11,13-14,16-17,23H,4-5,12,15H2,1-3H3/q+2 |
| InChIKey | ZDLYZWSZUUICBS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|