C25H24Cl3F3N2O5 — CID 123408370
tert-butyl N-[5-[4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 123408370) has the molecular formula C25H24Cl3F3N2O5 and a molecular weight of 595.83 g/mol. Its IUPAC name is tert-butyl N-[5-[4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | tert-butyl N-[5-[4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 123408370 |
| Molecular Formula | C25H24Cl3F3N2O5 |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 594.07 |
| IUPAC Name | tert-butyl N-[5-[4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCc2cc(C(=O)CC(C[N+](=O)[O-])(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C25H24Cl3F3N2O5/c1-23(2,3)38-22(35)32-19-7-5-13-8-14(4-6-16(13)19)20(34)11-24(12-33(36)37,25(29,30)31)15-9-17(26)21(28)18(27)10-15/h4,6,8-10,19H,5,7,11-12H2,1-3H3,(H,32,35) |
| InChIKey | TWCFTMXNDLVKOY-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|