C10H9NS — CID 123408513
2-methyl-6H-cycloocta[d][1,3]thiazole (PubChem CID 123408513) has the molecular formula C10H9NS and a molecular weight of 175.26 g/mol. Its IUPAC name is 2-methyl-6H-cycloocta[d][1,3]thiazole.
| Compound Name | 2-methyl-6H-cycloocta[d][1,3]thiazole |
|---|---|
| PubChem CID | 123408513 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 2-methyl-6H-cycloocta[d][1,3]thiazole |
| SMILES | Cc1nc2c(s1)=CC=CCC=C=2 |
| InChI | InChI=1S/C10H9NS/c1-8-11-9-6-4-2-3-5-7-10(9)12-8/h3-5,7H,2H2,1H3 |
| InChIKey | OFIOEMRYLNBOFG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |