C26H55N5O3 — CID 123409400
N-(3-aminopropyl)-N'-(2-hydroxypropyl)-2,3,3,4,4,5-hexamethyl-2,5-bis[2-(methylamino)propan-2-yl]hexanediamide (PubChem CID 123409400) has the molecular formula C26H55N5O3 and a molecular weight of 485.76 g/mol. Its IUPAC name is N-(3-aminopropyl)-N'-(2-hydroxypropyl)-2,3,3,4,4,5-hexamethyl-2,5-bis[2-(methylamino)propan-2-yl]hexanediamide.
| Compound Name | N-(3-aminopropyl)-N'-(2-hydroxypropyl)-2,3,3,4,4,5-hexamethyl-2,5-bis[2-(methylamino)propan-2-yl]hexanediamide |
|---|---|
| PubChem CID | 123409400 |
| Molecular Formula | C26H55N5O3 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.43 |
| IUPAC Name | N-(3-aminopropyl)-N'-(2-hydroxypropyl)-2,3,3,4,4,5-hexamethyl-2,5-bis[2-(methylamino)propan-2-yl]hexanediamide |
| SMILES | CNC(C)(C)C(C)(C(=O)NCCCN)C(C)(C)C(C)(C)C(C)(C(=O)NCC(C)O)C(C)(C)NC |
| InChI | InChI=1S/C26H55N5O3/c1-18(32)17-31-20(34)26(11,24(8,9)29-13)22(4,5)21(2,3)25(10,23(6,7)28-12)19(33)30-16-14-15-27/h18,28-29,32H,14-17,27H2,1-13H3,(H,30,33)(H,31,34) |
| InChIKey | JDQDVZQACQYWQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|