C20H26N4O3 — CID 123412297
N-[1-(3-amino-2-ethanimidoylphenoxy)-2-methylpropan-2-yl]-2-ethoxypyridine-4-carboxamide (PubChem CID 123412297) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[1-(3-amino-2-ethanimidoylphenoxy)-2-methylpropan-2-yl]-2-ethoxypyridine-4-carboxamide.
| Compound Name | N-[1-(3-amino-2-ethanimidoylphenoxy)-2-methylpropan-2-yl]-2-ethoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 123412297 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[1-(3-amino-2-ethanimidoylphenoxy)-2-methylpropan-2-yl]-2-ethoxypyridine-4-carboxamide |
| SMILES | [H]/N=C(\C)c1c(N)cccc1OCC(C)(C)NC(=O)c1ccnc(OCC)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-5-26-17-11-14(9-10-23-17)19(25)24-20(3,4)12-27-16-8-6-7-15(22)18(16)13(2)21/h6-11,21H,5,12,22H2,1-4H3,(H,24,25)/b21-13+ |
| InChIKey | NTCKJOBTLSXMNK-FYJGNVAPSA-N |
| XLogP | 3.04 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|