C19H22N6O2 — CID 123769245
N-[1-(3-amino-2-carbamimidoylphenoxy)-2-methylpropan-2-yl]imidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 123769245) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[1-(3-amino-2-carbamimidoylphenoxy)-2-methylpropan-2-yl]imidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-[1-(3-amino-2-carbamimidoylphenoxy)-2-methylpropan-2-yl]imidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 123769245 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[1-(3-amino-2-carbamimidoylphenoxy)-2-methylpropan-2-yl]imidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | [H]/N=C(\N)c1c(N)cccc1OCC(C)(C)NC(=O)c1ccn2ccnc2c1 |
| InChI | InChI=1S/C19H22N6O2/c1-19(2,11-27-14-5-3-4-13(20)16(14)17(21)22)24-18(26)12-6-8-25-9-7-23-15(25)10-12/h3-10H,11,20H2,1-2H3,(H3,21,22)(H,24,26) |
| InChIKey | SALUWEZTLVEGJJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|