C11H24Si — CID 123412592
1-(2,2,4-trimethylcyclohexyl)ethylsilane (PubChem CID 123412592) has the molecular formula C11H24Si and a molecular weight of 184.40 g/mol. Its IUPAC name is 1-(2,2,4-trimethylcyclohexyl)ethylsilane.
| Compound Name | 1-(2,2,4-trimethylcyclohexyl)ethylsilane |
|---|---|
| PubChem CID | 123412592 |
| Molecular Formula | C11H24Si |
| Molecular Weight | 184.40 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(2,2,4-trimethylcyclohexyl)ethylsilane |
| SMILES | CC1CCC(C(C)[SiH3])C(C)(C)C1 |
| InChI | InChI=1S/C11H24Si/c1-8-5-6-10(9(2)12)11(3,4)7-8/h8-10H,5-7H2,1-4,12H3 |
| InChIKey | RVWNNZMNFMQXTD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|