C26H28N4O3 — CID 123412939
3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-(2-ethylimidazol-1-yl)phenyl]pyrrol-2-yl]propanoic acid (PubChem CID 123412939) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-(2-ethylimidazol-1-yl)phenyl]pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-(2-ethylimidazol-1-yl)phenyl]pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 123412939 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-(2-ethylimidazol-1-yl)phenyl]pyrrol-2-yl]propanoic acid |
| SMILES | CCc1nccn1-c1ccc(-c2ccc(CCC(=O)O)n2-c2ccc(C(N)O)cc2C)cc1 |
| InChI | InChI=1S/C26H28N4O3/c1-3-24-28-14-15-29(24)20-7-4-18(5-8-20)23-12-9-21(10-13-25(31)32)30(23)22-11-6-19(26(27)33)16-17(22)2/h4-9,11-12,14-16,26,33H,3,10,13,27H2,1-2H3,(H,31,32) |
| InChIKey | XQHXFOYTHZVBFK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|