C23H23F3N2O4 — CID 123979217
3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-methoxy-2-(trifluoromethyl)phenyl]pyrrol-2-yl]propanoic acid (PubChem CID 123979217) has the molecular formula C23H23F3N2O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is 3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-methoxy-2-(trifluoromethyl)phenyl]pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-methoxy-2-(trifluoromethyl)phenyl]pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 123979217 |
| Molecular Formula | C23H23F3N2O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-[1-[4-[amino(hydroxy)methyl]-2-methylphenyl]-5-[4-methoxy-2-(trifluoromethyl)phenyl]pyrrol-2-yl]propanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(=O)O)n2-c2ccc(C(N)O)cc2C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F3N2O4/c1-13-11-14(22(27)31)3-8-19(13)28-15(5-10-21(29)30)4-9-20(28)17-7-6-16(32-2)12-18(17)23(24,25)26/h3-4,6-9,11-12,22,31H,5,10,27H2,1-2H3,(H,29,30) |
| InChIKey | URSIHKCCCZOFOL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|