C22H22BrN3O4 — CID 174650608
3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(5-bromo-2-methoxyphenyl)pyrrol-2-yl]propanoic acid (PubChem CID 174650608) has the molecular formula C22H22BrN3O4 and a molecular weight of 472.34 g/mol. Its IUPAC name is 3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(5-bromo-2-methoxyphenyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(5-bromo-2-methoxyphenyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 174650608 |
| Molecular Formula | C22H22BrN3O4 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(5-bromo-2-methoxyphenyl)pyrrol-2-yl]propanoic acid |
| SMILES | COc1ccc(Br)cc1-c1ccc(CCC(=O)O)n1-c1ccc(C(N)=O)cc1CN |
| InChI | InChI=1S/C22H22BrN3O4/c1-30-20-8-3-15(23)11-17(20)19-7-4-16(5-9-21(27)28)26(19)18-6-2-13(22(25)29)10-14(18)12-24/h2-4,6-8,10-11H,5,9,12,24H2,1H3,(H2,25,29)(H,27,28) |
| InChIKey | QIDBOSKDALHTPI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|