C19H17BrN2O3S — CID 46174244
3-[5-(4-bromothiophen-2-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoic acid (PubChem CID 46174244) has the molecular formula C19H17BrN2O3S and a molecular weight of 433.33 g/mol. Its IUPAC name is 3-[5-(4-bromothiophen-2-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[5-(4-bromothiophen-2-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 46174244 |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 3-[5-(4-bromothiophen-2-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoic acid |
| SMILES | Cc1cc(C(N)=O)ccc1-n1c(CCC(=O)O)ccc1-c1cc(Br)cs1 |
| InChI | InChI=1S/C19H17BrN2O3S/c1-11-8-12(19(21)25)2-5-15(11)22-14(4-7-18(23)24)3-6-16(22)17-9-13(20)10-26-17/h2-3,5-6,8-10H,4,7H2,1H3,(H2,21,25)(H,23,24) |
| InChIKey | UHHAVROFHYDSEL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|