C25H25N5O4 — CID 174650629
3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(4-imidazol-1-yl-2-methoxyphenyl)pyrrol-2-yl]propanoic acid (PubChem CID 174650629) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(4-imidazol-1-yl-2-methoxyphenyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(4-imidazol-1-yl-2-methoxyphenyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 174650629 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-[1-[2-(aminomethyl)-4-carbamoylphenyl]-5-(4-imidazol-1-yl-2-methoxyphenyl)pyrrol-2-yl]propanoic acid |
| SMILES | COc1cc(-n2ccnc2)ccc1-c1ccc(CCC(=O)O)n1-c1ccc(C(N)=O)cc1CN |
| InChI | InChI=1S/C25H25N5O4/c1-34-23-13-19(29-11-10-28-15-29)3-6-20(23)22-8-4-18(5-9-24(31)32)30(22)21-7-2-16(25(27)33)12-17(21)14-26/h2-4,6-8,10-13,15H,5,9,14,26H2,1H3,(H2,27,33)(H,31,32) |
| InChIKey | FYVDIROAFFBCTL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|