C15H19N3 — CID 123413107
4-[(2-cyclopropyl-5-methylidene-1H-imidazol-4-ylidene)methyl]-N-methyl-3-methylidenepent-4-en-2-imine (PubChem CID 123413107) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-[(2-cyclopropyl-5-methylidene-1H-imidazol-4-ylidene)methyl]-N-methyl-3-methylidenepent-4-en-2-imine.
| Compound Name | 4-[(2-cyclopropyl-5-methylidene-1H-imidazol-4-ylidene)methyl]-N-methyl-3-methylidenepent-4-en-2-imine |
|---|---|
| PubChem CID | 123413107 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-[(2-cyclopropyl-5-methylidene-1H-imidazol-4-ylidene)methyl]-N-methyl-3-methylidenepent-4-en-2-imine |
| SMILES | C=C(C=c1nc(C2CC2)[nH]c1=C)C(=C)/C(C)=N/C |
| InChI | InChI=1S/C15H19N3/c1-9(10(2)11(3)16-5)8-14-12(4)17-15(18-14)13-6-7-13/h8,13H,1-2,4,6-7H2,3,5H3,(H,17,18)/b14-8?,16-11+ |
| InChIKey | UDISAIOURMBTBX-SKTXVDFESA-N |
| XLogP | 1.68 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|