C8H13N — CID 123413356
2,6-dimethylcyclohex-2-en-1-imine (PubChem CID 123413356) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 2,6-dimethylcyclohex-2-en-1-imine.
| Compound Name | 2,6-dimethylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123413356 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 2,6-dimethylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C(C)=CCCC1C |
| InChI | InChI=1S/C8H13N/c1-6-4-3-5-7(2)8(6)9/h4,7,9H,3,5H2,1-2H3/b9-8+ |
| InChIKey | GENMIUVLQXMIRZ-CMDGGOBGSA-N |
| XLogP | 2.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|