C12H17N5OS — CID 123413482
4-(2H-tetrazol-5-ylamino)-4-(thiophen-2-ylmethyl)cyclohexan-1-ol (PubChem CID 123413482) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is 4-(2H-tetrazol-5-ylamino)-4-(thiophen-2-ylmethyl)cyclohexan-1-ol.
| Compound Name | 4-(2H-tetrazol-5-ylamino)-4-(thiophen-2-ylmethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 123413482 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-(2H-tetrazol-5-ylamino)-4-(thiophen-2-ylmethyl)cyclohexan-1-ol |
| SMILES | OC1CCC(Cc2cccs2)(Nc2nn[nH]n2)CC1 |
| InChI | InChI=1S/C12H17N5OS/c18-9-3-5-12(6-4-9,8-10-2-1-7-19-10)13-11-14-16-17-15-11/h1-2,7,9,18H,3-6,8H2,(H2,13,14,15,16,17) |
| InChIKey | BSQUBJDRLGQUJU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |