C20H19NO4S — CID 123414265
2-[4-[[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]oxy]phenyl]acetaldehyde (PubChem CID 123414265) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-[4-[[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]oxy]phenyl]acetaldehyde.
| Compound Name | 2-[4-[[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]oxy]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 123414265 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[4-[[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]oxy]phenyl]acetaldehyde |
| SMILES | CC(C)Oc1ccc(Oc2ncc(Oc3ccc(CC=O)cc3)s2)cc1 |
| InChI | InChI=1S/C20H19NO4S/c1-14(2)23-16-7-9-18(10-8-16)25-20-21-13-19(26-20)24-17-5-3-15(4-6-17)11-12-22/h3-10,12-14H,11H2,1-2H3 |
| InChIKey | AYCNQVAGHRZFCA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|