C17H17F2N3O — CID 123415449
3-amino-N-(2,3-difluoro-4-methylphenyl)-4-propanimidoylbenzamide (PubChem CID 123415449) has the molecular formula C17H17F2N3O and a molecular weight of 317.34 g/mol. Its IUPAC name is 3-amino-N-(2,3-difluoro-4-methylphenyl)-4-propanimidoylbenzamide.
| Compound Name | 3-amino-N-(2,3-difluoro-4-methylphenyl)-4-propanimidoylbenzamide |
|---|---|
| PubChem CID | 123415449 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-amino-N-(2,3-difluoro-4-methylphenyl)-4-propanimidoylbenzamide |
| SMILES | [H]/N=C(\CC)c1ccc(C(=O)Nc2ccc(C)c(F)c2F)cc1N |
| InChI | InChI=1S/C17H17F2N3O/c1-3-12(20)11-6-5-10(8-13(11)21)17(23)22-14-7-4-9(2)15(18)16(14)19/h4-8,20H,3,21H2,1-2H3,(H,22,23)/b20-12+ |
| InChIKey | IBXDJBRTOCXSMM-UDWIEESQSA-N |
| XLogP | 3.89 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|