C17H23N3O3 — CID 123415692
tert-butyl 5-[2-methanimidoyl-3-(methylamino)phenyl]-2,3-dihydro-1,4-oxazine-4-carboxylate (PubChem CID 123415692) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl 5-[2-methanimidoyl-3-(methylamino)phenyl]-2,3-dihydro-1,4-oxazine-4-carboxylate.
| Compound Name | tert-butyl 5-[2-methanimidoyl-3-(methylamino)phenyl]-2,3-dihydro-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 123415692 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl 5-[2-methanimidoyl-3-(methylamino)phenyl]-2,3-dihydro-1,4-oxazine-4-carboxylate |
| SMILES | [H]/N=C/c1c(NC)cccc1C1=COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23N3O3/c1-17(2,3)23-16(21)20-8-9-22-11-15(20)12-6-5-7-14(19-4)13(12)10-18/h5-7,10-11,18-19H,8-9H2,1-4H3/b18-10+ |
| InChIKey | CFSGDSAZOMGACG-VCHYOVAHSA-N |
| XLogP | 3.29 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|