C21H33NO5 — CID 123416256
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] pyrrolidine-1-carboxylate (PubChem CID 123416256) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] pyrrolidine-1-carboxylate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123416256 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] pyrrolidine-1-carboxylate |
| SMILES | COC1C(OC(=O)N2CCCC2)CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C21H33NO5/c1-14(2)7-8-16-20(3,27-16)18-17(24-4)15(9-10-21(18)13-25-21)26-19(23)22-11-5-6-12-22/h7,15-18H,5-6,8-13H2,1-4H3 |
| InChIKey | NOHXFYYQBOHPEP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|