C23H34NNaO8 — CID 138690037
sodium 2-[1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]-3-methylazetidin-3-yl]oxyacetate (PubChem CID 138690037) has the molecular formula C23H34NNaO8 and a molecular weight of 475.51 g/mol. Its IUPAC name is sodium 2-[1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]-3-methylazetidin-3-yl]oxyacetate.
| Compound Name | sodium 2-[1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]-3-methylazetidin-3-yl]oxyacetate |
|---|---|
| PubChem CID | 138690037 |
| Molecular Formula | C23H34NNaO8 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | sodium 2-[1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]-3-methylazetidin-3-yl]oxyacetate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N2CC(C)(OCC(=O)[O-])C2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C.[Na+] |
| InChI | InChI=1S/C23H35NO8.Na/c1-14(2)6-7-16-22(4,32-16)19-18(28-5)15(8-9-23(19)13-30-23)31-20(27)24-11-21(3,12-24)29-10-17(25)26;/h6,15-16,18-19H,7-13H2,1-5H3,(H,25,26);/q;+1/p-1/t15-,16-,18-,19-,22+,23+;/m1./s1 |
| InChIKey | IPNTXWBLZBGUBI-SVHGOTKISA-M |
| XLogP | -1.96 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|