C28H28BFN3O+ — CID 123416567
2-[4-[2-[4-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-2,6-dimethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]ethanamine (PubChem CID 123416567) has the molecular formula C28H28BFN3O+ and a molecular weight of 452.36 g/mol. Its IUPAC name is 2-[4-[2-[4-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-2,6-dimethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]ethanamine.
| Compound Name | 2-[4-[2-[4-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-2,6-dimethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]ethanamine |
|---|---|
| PubChem CID | 123416567 |
| Molecular Formula | C28H28BFN3O+ |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[4-[2-[4-[(4-fluorophenyl)methoxy]phenyl]ethenyl]-2,6-dimethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]ethanamine |
| SMILES | CB1n2c(C=Cc3ccc(OCc4ccc(F)cc4)cc3)cc(C)c2C(CCN)=C2C=CC=[N+]12 |
| InChI | InChI=1S/C28H28BFN3O/c1-20-18-24(33-28(20)26(15-16-31)27-4-3-17-32(27)29(33)2)12-7-21-8-13-25(14-9-21)34-19-22-5-10-23(30)11-6-22/h3-14,17-18H,15-16,19,31H2,1-2H3/q+1 |
| InChIKey | YUQABOZWHXOSEG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 43.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|