C33H46N10O9S2 — CID 123416739
2-[3-benzylidene-20-carbamoyl-12-[4-(diaminomethylideneamino)butyl]-2,5,8,11,14,22-hexaoxo-17,18-dithia-1,4,7,10,13,21-hexazabicyclo[21.3.0]hexacosan-6-yl]acetic acid (PubChem CID 123416739) has the molecular formula C33H46N10O9S2 and a molecular weight of 790.93 g/mol. Its IUPAC name is 2-[3-benzylidene-20-carbamoyl-12-[4-(diaminomethylideneamino)butyl]-2,5,8,11,14,22-hexaoxo-17,18-dithia-1,4,7,10,13,21-hexazabicyclo[21.3.0]hexacosan-6-yl]acetic acid.
| Compound Name | 2-[3-benzylidene-20-carbamoyl-12-[4-(diaminomethylideneamino)butyl]-2,5,8,11,14,22-hexaoxo-17,18-dithia-1,4,7,10,13,21-hexazabicyclo[21.3.0]hexacosan-6-yl]acetic acid |
|---|---|
| PubChem CID | 123416739 |
| Molecular Formula | C33H46N10O9S2 |
| Molecular Weight | 790.93 g/mol |
| Exact Mass | 790.29 |
| IUPAC Name | 2-[3-benzylidene-20-carbamoyl-12-[4-(diaminomethylideneamino)butyl]-2,5,8,11,14,22-hexaoxo-17,18-dithia-1,4,7,10,13,21-hexazabicyclo[21.3.0]hexacosan-6-yl]acetic acid |
| SMILES | NC(=O)C1CSSCCC(=O)NC(CCCCN=C(N)N)C(=O)NCC(=O)NC(CC(=O)O)C(=O)NC(=Cc2ccccc2)C(=O)N2CCCC2C(=O)N1 |
| InChI | InChI=1S/C33H46N10O9S2/c34-28(48)23-18-54-53-14-11-25(44)39-20(9-4-5-12-37-33(35)36)29(49)38-17-26(45)40-21(16-27(46)47)30(50)41-22(15-19-7-2-1-3-8-19)32(52)43-13-6-10-24(43)31(51)42-23/h1-3,7-8,15,20-21,23-24H,4-6,9-14,16-18H2,(H2,34,48)(H,38,49)(H,39,44)(H,40,45)(H,41,50)(H,42,51)(H,46,47)(H4,35,36,37) |
| InChIKey | CDLVZQCUVHAEGF-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 310.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.93 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|