C17H19NO6 — CID 123416880
ethyl 2-(5,5-diacetyl-4-phenyl-4H-1,2-oxazol-3-yl)-2-hydroxyacetate (PubChem CID 123416880) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is ethyl 2-(5,5-diacetyl-4-phenyl-4H-1,2-oxazol-3-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(5,5-diacetyl-4-phenyl-4H-1,2-oxazol-3-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 123416880 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | ethyl 2-(5,5-diacetyl-4-phenyl-4H-1,2-oxazol-3-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)C1=NOC(C(C)=O)(C(C)=O)C1c1ccccc1 |
| InChI | InChI=1S/C17H19NO6/c1-4-23-16(22)15(21)14-13(12-8-6-5-7-9-12)17(10(2)19,11(3)20)24-18-14/h5-9,13,15,21H,4H2,1-3H3 |
| InChIKey | QHACMLBIOJRJON-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|