C9H15NO — CID 123417580
N-methoxy-4-methylhepta-4,6-dien-3-imine (PubChem CID 123417580) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-methoxy-4-methylhepta-4,6-dien-3-imine.
| Compound Name | N-methoxy-4-methylhepta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 123417580 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-methoxy-4-methylhepta-4,6-dien-3-imine |
| SMILES | C=CC=C(C)C(CC)=NOC |
| InChI | InChI=1S/C9H15NO/c1-5-7-8(3)9(6-2)10-11-4/h5,7H,1,6H2,2-4H3 |
| InChIKey | SVLHEVCAOQBPJE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|