C8H7NO2 — CID 86164698
(6-methoxyiminocyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 86164698) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is (6-methoxyiminocyclohexa-2,4-dien-1-ylidene)methanone.
| Compound Name | (6-methoxyiminocyclohexa-2,4-dien-1-ylidene)methanone |
|---|---|
| PubChem CID | 86164698 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | (6-methoxyiminocyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | CON=C1C=CC=CC1=C=O |
| InChI | InChI=1S/C8H7NO2/c1-11-9-8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
| InChIKey | ZPENEEZHRPEIAV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|