C9H7NO — CID 86223317
2,1-benzoxazepine (PubChem CID 86223317) has the molecular formula C9H7NO and a molecular weight of 145.16 g/mol. Its IUPAC name is 2,1-benzoxazepine.
| Compound Name | 2,1-benzoxazepine |
|---|---|
| PubChem CID | 86223317 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 2,1-benzoxazepine |
| SMILES | C1=CON=c2ccccc2=C1 |
| InChI | InChI=1S/C9H7NO/c1-2-6-9-8(4-1)5-3-7-11-10-9/h1-7H |
| InChIKey | LYIMGNBKXPRWHN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |