C8H7NO — CID 24975403
(6-methyliminocyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 24975403) has the molecular formula C8H7NO and a molecular weight of 133.15 g/mol. Its IUPAC name is (6-methyliminocyclohexa-2,4-dien-1-ylidene)methanone.
| Compound Name | (6-methyliminocyclohexa-2,4-dien-1-ylidene)methanone |
|---|---|
| PubChem CID | 24975403 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | (6-methyliminocyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | C/N=C1\C=CC=CC1=C=O |
| InChI | InChI=1S/C8H7NO/c1-9-8-5-3-2-4-7(8)6-10/h2-5H,1H3/b9-8+ |
| InChIKey | FZBBEBSDMBPFTF-CMDGGOBGSA-N |
| XLogP | 0.94 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|