C9H11NO — CID 12504459
N-(4-methylcyclohexa-2,4-dien-1-ylidene)acetamide (PubChem CID 12504459) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is N-(4-methylcyclohexa-2,4-dien-1-ylidene)acetamide.
| Compound Name | N-(4-methylcyclohexa-2,4-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 12504459 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-(4-methylcyclohexa-2,4-dien-1-ylidene)acetamide |
| SMILES | CC(=O)/N=C1/C=CC(C)=CC1 |
| InChI | InChI=1S/C9H11NO/c1-7-3-5-9(6-4-7)10-8(2)11/h3-5H,6H2,1-2H3/b10-9- |
| InChIKey | ISJHPSHTYPJHGE-KTKRTIGZSA-N |
| XLogP | 1.88 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|