About indol-2-ylidenemethanone
indol-2-ylidenemethanone (PubChem CID 12913531) has the molecular formula C9H5NO
and a molecular weight of 143.14 g/mol. Its IUPAC name is indol-2-ylidenemethanone.
Molecular Properties
| Compound Name | indol-2-ylidenemethanone |
| PubChem CID | 12913531 |
| Molecular Formula | C9H5NO |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | indol-2-ylidenemethanone |
| SMILES | O=C=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C9H5NO/c11-6-8-5-7-3-1-2-4-9(7)10-8/h1-5H |
| InChIKey | YSMMOVBWZRIVPM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze indol-2-ylidenemethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-ylidenemethanone?
The IUPAC name of indol-2-ylidenemethanone (CID 12913531) is indol-2-ylidenemethanone.
What is the SMILES notation for indol-2-ylidenemethanone?
The canonical SMILES for indol-2-ylidenemethanone is O=C=C1C=c2ccccc2=N1.
What is the InChIKey of indol-2-ylidenemethanone?
The InChIKey is YSMMOVBWZRIVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO/c11-6-8-5-7-3-1-2-4-9(7)10-8/h1-5H.
What are the key properties of indol-2-ylidenemethanone?
indol-2-ylidenemethanone has a molecular weight of 143.14 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-ylidenemethanone is sourced from PubChem (CID 12913531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).