C8H26O3Si4 — CID 123417936
[1,1-bis(dimethylsilyloxy)-2-silylethoxy]-dimethylsilane (PubChem CID 123417936) has the molecular formula C8H26O3Si4 and a molecular weight of 282.64 g/mol. Its IUPAC name is [1,1-bis(dimethylsilyloxy)-2-silylethoxy]-dimethylsilane.
| Compound Name | [1,1-bis(dimethylsilyloxy)-2-silylethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123417936 |
| Molecular Formula | C8H26O3Si4 |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [1,1-bis(dimethylsilyloxy)-2-silylethoxy]-dimethylsilane |
| SMILES | C[SiH](C)OC(C[SiH3])(O[SiH](C)C)O[SiH](C)C |
| InChI | InChI=1S/C8H26O3Si4/c1-13(2)9-8(7-12,10-14(3)4)11-15(5)6/h13-15H,7H2,1-6,12H3 |
| InChIKey | WATMZBUCGVDEOC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|