C24H39NO — CID 123418352
3-[3-(dimethylamino)propyl]-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 123418352) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-[3-(dimethylamino)propyl]-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123418352 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CN(C)CCCC1C=C2CCC3C4CCC(=O)C4(C)CCC3C2(C)CC1 |
| InChI | InChI=1S/C24H39NO/c1-23-13-11-17(6-5-15-25(3)4)16-18(23)7-8-19-20-9-10-22(26)24(20,2)14-12-21(19)23/h16-17,19-21H,5-15H2,1-4H3 |
| InChIKey | WHEGNIIHBJDDLR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|