C36H54BN7O8 — CID 123418641
[amino-[[3-[[6-amino-2-[[4-(4-butylphenyl)benzoyl]amino]hexanoyl]amino]-6-methyl-4,7-dioxo-1-oxa-5,8-diazacyclotridecane-9-carbonyl]amino]methyl]boronic acid (PubChem CID 123418641) has the molecular formula C36H54BN7O8 and a molecular weight of 723.68 g/mol. Its IUPAC name is [amino-[[3-[[6-amino-2-[[4-(4-butylphenyl)benzoyl]amino]hexanoyl]amino]-6-methyl-4,7-dioxo-1-oxa-5,8-diazacyclotridecane-9-carbonyl]amino]methyl]boronic acid.
| Compound Name | [amino-[[3-[[6-amino-2-[[4-(4-butylphenyl)benzoyl]amino]hexanoyl]amino]-6-methyl-4,7-dioxo-1-oxa-5,8-diazacyclotridecane-9-carbonyl]amino]methyl]boronic acid |
|---|---|
| PubChem CID | 123418641 |
| Molecular Formula | C36H54BN7O8 |
| Molecular Weight | 723.68 g/mol |
| Exact Mass | 723.41 |
| IUPAC Name | [amino-[[3-[[6-amino-2-[[4-(4-butylphenyl)benzoyl]amino]hexanoyl]amino]-6-methyl-4,7-dioxo-1-oxa-5,8-diazacyclotridecane-9-carbonyl]amino]methyl]boronic acid |
| SMILES | CCCCc1ccc(-c2ccc(C(=O)NC(CCCCN)C(=O)NC3COCCCCC(C(=O)NC(N)B(O)O)NC(=O)C(C)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C36H54BN7O8/c1-3-4-9-24-12-14-25(15-13-24)26-16-18-27(19-17-26)32(46)42-28(10-5-7-20-38)33(47)43-30-22-52-21-8-6-11-29(34(48)44-36(39)37(50)51)41-31(45)23(2)40-35(30)49/h12-19,23,28-30,36,50-51H,3-11,20-22,38-39H2,1-2H3,(H,40,49)(H,41,45)(H,42,46)(H,43,47)(H,44,48) |
| InChIKey | LISIZWCTUPGYSD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 247.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.68 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|