C39H56N6O6 — CID 90184400
N-[(2S)-6-amino-1-[[(2S,5S,13S)-5-butanoyl-2-methyl-3,10,14-trioxo-1,4,9-triazacyclotetradec-13-yl]amino]-1-oxohexan-2-yl]-4-(4-butylphenyl)benzamide (PubChem CID 90184400) has the molecular formula C39H56N6O6 and a molecular weight of 704.91 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-[[(2S,5S,13S)-5-butanoyl-2-methyl-3,10,14-trioxo-1,4,9-triazacyclotetradec-13-yl]amino]-1-oxohexan-2-yl]-4-(4-butylphenyl)benzamide.
| Compound Name | N-[(2S)-6-amino-1-[[(2S,5S,13S)-5-butanoyl-2-methyl-3,10,14-trioxo-1,4,9-triazacyclotetradec-13-yl]amino]-1-oxohexan-2-yl]-4-(4-butylphenyl)benzamide |
|---|---|
| PubChem CID | 90184400 |
| Molecular Formula | C39H56N6O6 |
| Molecular Weight | 704.91 g/mol |
| Exact Mass | 704.43 |
| IUPAC Name | N-[(2S)-6-amino-1-[[(2S,5S,13S)-5-butanoyl-2-methyl-3,10,14-trioxo-1,4,9-triazacyclotetradec-13-yl]amino]-1-oxohexan-2-yl]-4-(4-butylphenyl)benzamide |
| SMILES | CCCCc1ccc(-c2ccc(C(=O)N[C@@H](CCCCN)C(=O)N[C@H]3CCC(=O)NCCC[C@@H](C(=O)CCC)NC(=O)[C@H](C)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C39H56N6O6/c1-4-6-11-27-14-16-28(17-15-27)29-18-20-30(21-19-29)37(49)44-32(12-7-8-24-40)39(51)45-33-22-23-35(47)41-25-9-13-31(34(46)10-5-2)43-36(48)26(3)42-38(33)50/h14-21,26,31-33H,4-13,22-25,40H2,1-3H3,(H,41,47)(H,42,50)(H,43,48)(H,44,49)(H,45,51)/t26-,31-,32-,33-/m0/s1 |
| InChIKey | AUJMXEGAQLZZRO-LLKLPMJSSA-N |
| XLogP | 3.46 |
| TPSA | 188.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|