C24H51N — CID 123419359
2,5-dimethyl-7-propan-2-yl-N,N,6-tripropyldecan-1-amine (PubChem CID 123419359) has the molecular formula C24H51N and a molecular weight of 353.68 g/mol. Its IUPAC name is 2,5-dimethyl-7-propan-2-yl-N,N,6-tripropyldecan-1-amine.
| Compound Name | 2,5-dimethyl-7-propan-2-yl-N,N,6-tripropyldecan-1-amine |
|---|---|
| PubChem CID | 123419359 |
| Molecular Formula | C24H51N |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 353.40 |
| IUPAC Name | 2,5-dimethyl-7-propan-2-yl-N,N,6-tripropyldecan-1-amine |
| SMILES | CCCC(C(C)C)C(CCC)C(C)CCC(C)CN(CCC)CCC |
| InChI | InChI=1S/C24H51N/c1-9-13-23(20(5)6)24(14-10-2)22(8)16-15-21(7)19-25(17-11-3)18-12-4/h20-24H,9-19H2,1-8H3 |
| InChIKey | BLUQKZCUDSCMFL-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |