C12H14FN2O2+ — CID 123419863
5-(3-fluorophenyl)-4-(hydroxymethyl)-3,3-dimethyl-1H-imidazol-3-ium-2-one (PubChem CID 123419863) has the molecular formula C12H14FN2O2+ and a molecular weight of 237.25 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-(hydroxymethyl)-3,3-dimethyl-1H-imidazol-3-ium-2-one.
| Compound Name | 5-(3-fluorophenyl)-4-(hydroxymethyl)-3,3-dimethyl-1H-imidazol-3-ium-2-one |
|---|---|
| PubChem CID | 123419863 |
| Molecular Formula | C12H14FN2O2+ |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 5-(3-fluorophenyl)-4-(hydroxymethyl)-3,3-dimethyl-1H-imidazol-3-ium-2-one |
| SMILES | C[N+]1(C)C(=O)NC(c2cccc(F)c2)=C1CO |
| InChI | InChI=1S/C12H13FN2O2/c1-15(2)10(7-16)11(14-12(15)17)8-4-3-5-9(13)6-8/h3-6,16H,7H2,1-2H3/p+1 |
| InChIKey | BZCUCLHUDUUHEH-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|