C11H12FN3O3 — CID 57012206
1-[[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]-1-hydroxyurea (PubChem CID 57012206) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 57012206 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)CC1C=C(c2ccc(F)cc2)NO1 |
| InChI | InChI=1S/C11H12FN3O3/c12-8-3-1-7(2-4-8)10-5-9(18-14-10)6-15(17)11(13)16/h1-5,9,14,17H,6H2,(H2,13,16) |
| InChIKey | ICZKGVLVVZFOHI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|